- N-Cbz-D-Alanine
-
-
2026-07-03
- CAS:26607-51-2
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 500kgs
- Cbz-D-Ala-OH
-
-
2026-07-03
- CAS:26607-51-2
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | N-Cbz-D-Alanine Basic information |
| | N-Cbz-D-Alanine Chemical Properties |
| Melting point | 83-84°C | | Boiling point | 422.1±38.0 °C(Predicted) | | density | 1.246±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | almost transparency in Methanol | | pka | 4.00±0.10(Predicted) | | form | Crystalline Powder | | color | White to off-white | | Optical Rotation | Consistent with structure | | BRN | 2056163 | | InChI | InChI=1S/C11H13NO4/c1-8(10(13)14)12-11(15)16-7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,12,15)(H,13,14)/t8-/m1/s1 | | InChIKey | TYRGLVWXHJRKMT-MRVPVSSYSA-N | | SMILES | C(O)(=O)[C@@H](C)NC(OCC1=CC=CC=C1)=O | | CAS DataBase Reference | 26607-51-2(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29224999 |
| | N-Cbz-D-Alanine Usage And Synthesis |
| Chemical Properties | White to off-white solid | | Uses | N-Cbz-D-alanine is the Cbz-protected form of D-Alanine (A480995). D-Alanine is an amino acid that is commonly found in bacteria, such as Streptococcus faecalis. It is essential for the biosynthesis of peptidoglycan crosslinking sub-units that are used for bacterial cell walls. D-Alanine is also known to cause cytotoxic oxidative stress in brain tumour cells. |
| | N-Cbz-D-Alanine Preparation Products And Raw materials |
|