|
|
| | 3,4-Dimethylphenylhydrazine hydrochloride Basic information |
| Product Name: | 3,4-Dimethylphenylhydrazine hydrochloride | | Synonyms: | LABOTEST-BB LT01148173;3,4-DIMETHYLPHENYLHYDRAZINE HYDROCHLORIDE;3,4-DIMETHYLPHENYLHYDRAZINE HCL;3,4-DiMethylphenylhy;(3,4-dimethylphenyl)-Hydrazine hydrochloride (1:);(3,4-Dimethylphenyl)hydrazine xhydrochloride | | CAS: | 86746-50-1 | | MF: | C8H13ClN2 | | MW: | 172.66 | | EINECS: | | | Product Categories: | | | Mol File: | 86746-50-1.mol |  |
| | 3,4-Dimethylphenylhydrazine hydrochloride Chemical Properties |
| Melting point | 195-200 °C(lit.) | | InChI | InChI=1S/C8H12N2.ClH/c1-6-3-4-8(10-9)5-7(6)2;/h3-5,10H,9H2,1-2H3;1H | | InChIKey | YYMIOVAEQIEPET-UHFFFAOYSA-N | | SMILES | N(C1=CC=C(C)C(C)=C1)N.[H]Cl | | CAS DataBase Reference | 86746-50-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 |
| | 3,4-Dimethylphenylhydrazine hydrochloride Usage And Synthesis |
| | 3,4-Dimethylphenylhydrazine hydrochloride Preparation Products And Raw materials |
|