|
|
| | 1,1-Cyclohexane diacetic anhydride Basic information |
| Product Name: | 1,1-Cyclohexane diacetic anhydride | | Synonyms: | 1,1-Cyclohexanediacetic acid anhydride;1,1-CYCLOHEXANEDIAAETIC ANHYDRIDE;1,1-Cyclohexanediacetic anhydride(CDAAN) or 3-Oxaspiro{5,5} undecane-2,4-dione;1,1-CYCLOHEXANEDIACETIC ANHYDRIDE;1,1-Cyclohexanediacetic anhydride,98%;1,1-Cyclohexanediace;3,3-Pentamethyleneglutaric Anhydride
3-Oxaspiro[5.5]-2,4-undecanedione;TIMTEC-BB SBB008597 | | CAS: | 1010-26-0 | | MF: | C10H14O3 | | MW: | 182.22 | | EINECS: | | | Product Categories: | Heterocyclic Building Blocks;O-Containing;(intermediate of gabapentin);Organic acids;Heterocyclic Compounds;Others | | Mol File: | 1010-26-0.mol |  |
| | 1,1-Cyclohexane diacetic anhydride Chemical Properties |
| Melting point | 67-70 °C(lit.) | | Boiling point | 126°C/0.5mmHg(lit.) | | density | 1.15±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder to crystal | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C10H14O3/c11-8-6-10(7-9(12)13-8)4-2-1-3-5-10/h1-7H2 | | InChIKey | XNDSIASQMRYFSW-UHFFFAOYSA-N | | SMILES | C1C2(CCCCC2)CC(=O)OC1=O | | CAS DataBase Reference | 1010-26-0(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29172090 | | Storage Class | 11 - Combustible Solids |
| | 1,1-Cyclohexane diacetic anhydride Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder or chunks | | Uses | 3-Oxaspiro[5,5]undecane-2,4-dione may be used to synthesize [1-(2-{[4-chloro-2-(methoxycarbonyl)phenyl]amino}-2-oxoethyl)cyclohexyl]acetic acid. |
| | 1,1-Cyclohexane diacetic anhydride Preparation Products And Raw materials |
|