- H-L-Glu(OtBu)-OH
-
- $0.00 / 1kg
-
2026-01-06
- CAS:2419-56-9
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | L-Glutamic acid 5-tert-butyl ester Basic information |
| | L-Glutamic acid 5-tert-butyl ester Chemical Properties |
| Melting point | 182°C(lit.) | | Boiling point | 110 °C(Press: 0.05 Torr) | | density | 0.992 g/cm3 | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Solid | | pka | 2.20±0.10(Predicted) | | color | White to Almost white | | Water Solubility | Sparingly soluble in water; practically insoluble in ethanol or ether. | | BRN | 2049031 | | InChI | InChI=1S/C9H17NO4/c1-9(2,3)14-7(11)5-4-6(10)8(12)13/h6H,4-5,10H2,1-3H3,(H,12,13)/t6-/m0/s1 | | InChIKey | OIOAKXPMBIZAHL-LURJTMIESA-N | | SMILES | C(O)(=O)[C@H](CCC(OC(C)(C)C)=O)N | | CAS DataBase Reference | 2419-56-9(CAS DataBase Reference) |
| Risk Statements | 22-24 | | Safety Statements | 22-24/25-25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29224999 |
| | L-Glutamic acid 5-tert-butyl ester Usage And Synthesis |
| Chemical Properties | White powder crystal | | Uses | L-Glutamic acid 5-tert-butyl ester is used as a fine chemical intermediate, pharmaceutical intermediate. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | L-Glutamic acid 5-tert-butyl ester Preparation Products And Raw materials |
|