| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 4-Methoxy-3-morpholin-4-ylmethyl-benzaldehyde Basic information |
| Product Name: | 4-Methoxy-3-morpholin-4-ylmethyl-benzaldehyde | | Synonyms: | ART-CHEM-BB B000991;AKOS B000991;4-METHOXY-3-(4-MORPHOLINYLMETHYL)BENZALDEHYDE;TIMTEC-BB SBB000738;4-Methoxy-3-(morpholinomethyl)benzaldehyde;Benzaldehyde, 4-methoxy-3-(4-morpholinylmethyl)-;4-Methoxy-3-morpholin-4-ylmethyl-benzaldehyde | | CAS: | 128501-81-5 | | MF: | C13H17NO3 | | MW: | 235.28 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 4-Methoxy-3-morpholin-4-ylmethyl-benzaldehyde Chemical Properties |
| form | solid | | InChI | 1S/C13H17NO3/c1-16-13-3-2-11(10-15)8-12(13)9-14-4-6-17-7-5-14/h2-3,8,10H,4-7,9H2,1H3 | | InChIKey | YHRYKKIGMYJYLB-UHFFFAOYSA-N | | SMILES | COC1=CC=C(C=O)C=C1CN2CCOCC2 |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 4-Methoxy-3-morpholin-4-ylmethyl-benzaldehyde Usage And Synthesis |
| Uses | 4-Methoxy-3-(morpholin-4-ylmethyl)benzaldehyde is used in the synthesis of 2-Aryl 1,2-Dihydro-4(3H)-quinazoline derivative possessing anticancer and antiparasitic activities and capable of preventing the progress of neurodegenerative diseases. |
| | 4-Methoxy-3-morpholin-4-ylmethyl-benzaldehyde Preparation Products And Raw materials |
|