|
|
| | 3-Cyclopentylpropionic acid Basic information |
| | 3-Cyclopentylpropionic acid Chemical Properties |
| Melting point | - | | Boiling point | 130-132 °C/12 mmHg (lit.) | | density | 0.996 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.457(lit.) | | Fp | 116 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 4.81±0.10(Predicted) | | form | Liquid | | color | Clear colorless to yellow | | Water Solubility | insoluble | | InChI | InChI=1S/C8H14O2/c9-8(10)6-5-7-3-1-2-4-7/h7H,1-6H2,(H,9,10) | | InChIKey | ZRPLANDPDWYOMZ-UHFFFAOYSA-N | | SMILES | C1(CCC(O)=O)CCCC1 | | CAS DataBase Reference | 140-77-2(CAS DataBase Reference) | | NIST Chemistry Reference | Cyclopentanepropanoic acid(140-77-2) | | EPA Substance Registry System | Cyclopentanepropanoic acid (140-77-2) |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36-24/25 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29162090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | 3-Cyclopentylpropionic acid Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS TO YELLOW LIQUID | | Uses |
3-Cyclopentylpropionic acid can be used as an organic building blocks in the synthesis of variety of pharmaceutical compound. It is used for the synthesis of Testosterone Cypionate (T155100).
| | Definition | ChEBI: A monocarboxylic acid that is propionic acid in which one of the methyl hydrogens is substituted by a cyclopentyl group. | | Synthesis | Process for the preparation of 3-cyclopentyI-propionic acid, characterized in that cyclopentanone or cyclopentanol in succession in two different temperature ranges with molten alkali hydroxide converts, the temperature of the first area 200 to 270 ° C and the temperature of the second area 290 to 350 ° C, and then the alkali obtained as the 3-cyclopentyl-propionic acid in the free Acid transferred.
|
| | 3-Cyclopentylpropionic acid Preparation Products And Raw materials |
|