| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
| Products Intro: |
Product Name:2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroheptyl acrylate
CAS:2993-85-3
Purity:95%
|
|
|
|
|
|
| | 1H,1H,7H-DODECAFLUOROHEPTYL ACRYLATE Basic information |
| Product Name: | 1H,1H,7H-DODECAFLUOROHEPTYL ACRYLATE | | Synonyms: | 1H,1H,7H-Dodecafluoroheptyl;1H,1H,7H-Dodecafluoroheptyl acrylate, 97%, stab. with ca 50ppm 4-methoxyphenol;2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoropentylacrylate;2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl prop-2-enoate;1H,1H,7H-Dodecafluoroheptyl acrylate, 97%, stab. with 50ppm 4-methoxyphenol;2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroheptyl acrylate, 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroheptyl prop-2-enoate;DFHA;2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroheptyl acrylate 95% | | CAS: | 2993-85-3 | | MF: | C10H6F12O2 | | MW: | 386.13 | | EINECS: | 221-064-8 | | Product Categories: | monomer;Acrylic Monomers;Fluorinated AcrylicsSelf Assembly&Contact Printing;Fluorine-Containing Monomers for 157 nm UV Lithography Resist Polymers;Lithography Monomers;Monomers | | Mol File: | 2993-85-3.mol |  |
| | 1H,1H,7H-DODECAFLUOROHEPTYL ACRYLATE Chemical Properties |
| Boiling point | 197 °C (lit.) | | density | 1.581 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.342(lit.) | | Fp | 215 °F | | storage temp. | 2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.581 | | BRN | 3563773 | | InChI | InChI=1S/C10H6F12O2/c1-2-4(23)24-3-6(13,14)8(17,18)10(21,22)9(19,20)7(15,16)5(11)12/h2,5H,1,3H2 | | InChIKey | QJEJDNMGOWJONG-UHFFFAOYSA-N | | SMILES | C(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)(=O)C=C | | CAS DataBase Reference | 2993-85-3(CAS DataBase Reference) | | EPA Substance Registry System | (6H-Perfluorohexyl)methyl acrylate (2993-85-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | UD3340500 | | Hazard Note | Irritant/Keep Cold | | HazardClass | IRRITANT, KEEP COLD | | HazardClass | 9 | | HS Code | 29161290 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1H,1H,7H-DODECAFLUOROHEPTYL ACRYLATE Usage And Synthesis |
| Uses | 1H,1H,7H-Dodecafluoroheptyl Acrylate (CAS# 2993-85-3) is a polymerizable liquid crystal that can be used as an optically anisotropic film, optical film, polarizing plate, and image display device. It can also be used to produce particulate vinyliden-fluoride-based polymer. | | General Description | 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroheptyl acrylate (DFHA) is a fluorous functional monomer that is majorly used in the surface functionalization. It can also be utilized in chemical vapor deposition process for the synthesis of nanomaterials. |
| | 1H,1H,7H-DODECAFLUOROHEPTYL ACRYLATE Preparation Products And Raw materials |
|