|
|
| | Cyclohexene-1-boronic acid pinacol ester Basic information |
| Product Name: | Cyclohexene-1-boronic acid pinacol ester | | Synonyms: | Cyclohex-1-ene-1-boronic acid, pinacol ester;CYCLOHEXENE-1-BORONIC ACID, PINACOL ESTER;2-CYCLOHEXENYL-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE;2-(1-CYCLOHEXEN-1-YL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE;2-(1-CYCLOHEXENYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE;1-CYCLOHEXEN-1-YL-BORONIC ACID PINACOL ESTER;1-CYCLOHEXENYL-BORONIC ACID PINACOL ESTER;1-CYCLOHEXENEBORONIC ACID, PINACOL ESTER | | CAS: | 141091-37-4 | | MF: | C12H21BO2 | | MW: | 208.1 | | EINECS: | | | Product Categories: | Alkyl;Organoborons;Alkenyl;Boronate Esters;Boronic Acids and Derivatives | | Mol File: | 141091-37-4.mol |  |
| | Cyclohexene-1-boronic acid pinacol ester Chemical Properties |
| Boiling point | 232.0±33.0 °C(Predicted) | | density | 0.968 | | refractive index | 1.4650-1.4690 | | Fp | 219 °F | | storage temp. | 2-8°C | | form | Liquid | | color | Clear colorless to tan | | Sensitive | Moisture Sensitive | | InChI | 1S/C12H21BO2/c1-11(2)12(3,4)15-13(14-11)10-8-6-5-7-9-10/h8H,5-7,9H2,1-4H3 | | InChIKey | QNZFUMVTUFOLRT-UHFFFAOYSA-N | | SMILES | CC1(C)OB(OC1(C)C)C2=CCCCC2 | | CAS DataBase Reference | 141091-37-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | TSCA | No | | HS Code | 2931900090 | | Storage Class | 10 - Combustible liquids |
| | Cyclohexene-1-boronic acid pinacol ester Usage And Synthesis |
| Uses | Cyclohexen-1-ylboronic acid, pinacol ester |
| | Cyclohexene-1-boronic acid pinacol ester Preparation Products And Raw materials |
|