5-Nitro-6-oxo-1,6-dihydro-pyridine-3-carboxylic acid methyl ester manufacturers
|
| | 5-Nitro-6-oxo-1,6-dihydro-pyridine-3-carboxylic acid methyl ester Basic information |
| | 5-Nitro-6-oxo-1,6-dihydro-pyridine-3-carboxylic acid methyl ester Chemical Properties |
| Boiling point | 365.4±42.0 °C(Predicted) | | density | 1.49 | | storage temp. | Sealed in dry,Room Temperature | | pka | 6.34±0.10(Predicted) | | Appearance | White to off-white Solid | | BRN | 195801 | | InChI | 1S/C7H6N2O5/c1-14-7(11)4-2-5(9(12)13)6(10)8-3-4/h2-3H,1H3,(H,8,10) | | InChIKey | ILGFGEIQCLRIBI-UHFFFAOYSA-N | | SMILES | COC(=O)c1cnc(O)c(c1)[N+]([O-])=O |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 | | WGK Germany | 3 | | HS Code | 2933399990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 5-Nitro-6-oxo-1,6-dihydro-pyridine-3-carboxylic acid methyl ester Usage And Synthesis |
| Uses | Methyl 6-hydroxy-5-nitropyridine-3-carboxylate (5-Nitro-6-oxo-1,6-dihydro-pyridine-3-carboxylic acid methyl ester) is a high purity and quality chemical used as heterocyclic building block. It is used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research. |
| | 5-Nitro-6-oxo-1,6-dihydro-pyridine-3-carboxylic acid methyl ester Preparation Products And Raw materials |
|