|
|
| | 3-METHYL-4-NITROBENZYL ALCOHOL Basic information |
| | 3-METHYL-4-NITROBENZYL ALCOHOL Chemical Properties |
| Melting point | 57-58 °C(lit.) | | Boiling point | 295.73°C (rough estimate) | | density | 1.2917 (rough estimate) | | refractive index | 1.5570 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder | | pka | 13.62±0.10(Predicted) | | color | yellow-orange | | BRN | 2363298 | | InChI | 1S/C8H9NO3/c1-6-4-7(5-10)2-3-8(6)9(11)12/h2-4,10H,5H2,1H3 | | InChIKey | KOVQGYQQVNCUBR-UHFFFAOYSA-N | | SMILES | Cc1cc(CO)ccc1[N+]([O-])=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29062990 | | Storage Class | 11 - Combustible Solids |
| | 3-METHYL-4-NITROBENZYL ALCOHOL Usage And Synthesis |
| Chemical Properties | yellow to ochre powder | | Uses | 3-Methyl-4-nitrobenzyl alcohol was used as starting reagent in the synthesis of 3-methyl-4-iodophenylalanine. |
| | 3-METHYL-4-NITROBENZYL ALCOHOL Preparation Products And Raw materials |
|