|
|
| | 2-Bromo-1-chloro-4-fluorobenzene Basic information |
| | 2-Bromo-1-chloro-4-fluorobenzene Chemical Properties |
| Boiling point | 202.1±20.0 °C(Predicted) | | density | 1.75 | | refractive index | 1.5530 | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C6H3BrClF/c7-5-3-4(9)1-2-6(5)8/h1-3H | | InChIKey | FOCCSIJMXBTKHD-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=C(F)C=C1Br | | CAS DataBase Reference | 201849-15-2(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 2-Bromo-1-chloro-4-fluorobenzene Usage And Synthesis |
| Description | 2-Bromo-1-chloro-4-fluorobenzene is an important aromatic halide that serves as a crucial intermediate in the synthesis of various organic compounds. |
| | 2-Bromo-1-chloro-4-fluorobenzene Preparation Products And Raw materials |
|