- 4-Nitrofluorescein
-
- $1.00 / 1KG
-
2024-07-11
- CAS:3326-35-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
|
| | 4-Nitrofluorescein Basic information |
| Product Name: | 4-Nitrofluorescein | | Synonyms: | 4-NITROFLUOROESCEIN;5-NITRO-3',6'-DIHYDROXYSPIRO[ISOBENZOFURAN-1(3H),9'-(9H)XANTHEN]-3-ONE;4-NITROFLUORESCEIN;3',6'-Dihydroxy-5-nitrospiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one;5-Nitro-3',6'-dihydroxyspiro[isobenzofuran-1(3H),9'-[9H]xanthene]-3-one;3',6'-dihydroxy-6-nitro-spiro[2-benzofuran-3,9'-xanthene]-1-one;3',6'-dihydroxy-6-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one;3',6'-dihydroxy-6-nitro-spiro[isobenzofuran-3,9'-xanthene]-1-one | | CAS: | 3326-35-0 | | MF: | C20H11NO7 | | MW: | 377.3 | | EINECS: | | | Product Categories: | Fluorescent Labels & Indicators | | Mol File: | 3326-35-0.mol |  |
| | 4-Nitrofluorescein Chemical Properties |
| Melting point | >300°C | | Boiling point | 692.0±55.0 °C(Predicted) | | density | 1.72±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | almost transparency in NaOH100g/L | | pka | 9.29±0.20(Predicted) | | form | powder to crystal | | color | Light yellow to Brown | | Stability: | Light and Moisture Sensitive | | InChI | InChI=1S/C20H11NO7/c22-11-2-5-15-17(8-11)27-18-9-12(23)3-6-16(18)20(15)14-4-1-10(21(25)26)7-13(14)19(24)28-20/h1-9,22-23H | | InChIKey | UACQOMKZFGNRBL-UHFFFAOYSA-N | | SMILES | C12(C3=C(C=C(O)C=C3)OC3=C1C=CC(O)=C3)C1=C(C=C([N+]([O-])=O)C=C1)C(=O)O2 | | EPA Substance Registry System | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-5-nitro- (3326-35-0) |
| TSCA | TSCA listed | | HS Code | 2932.99.7000 |
| | 4-Nitrofluorescein Usage And Synthesis |
| Chemical Properties | Orange Cyrstalline Solid | | Uses | Fluorescent labeling reagent for proteins. 4-Nitrofluorescein is used in the fluorescent antibody technique for rapid identification of pathogens. | | Synthesis | 4-Nitrofluorescein was prepared as follows: 8.6 g (18.7 mmol) of ethyl 4-nitrofluorescein triacetate was dissolved in 87 mL of 10% sodium hydroxide solution and 432 mL of methanol and gently heated. The precipitate was filtered and dissolved in 500 mL of water. The solution was acidified with hydrochloric acid and allowed to stand overnight in the dark. The crystals were filtered out and washed with water. 6.9 g (18.2 mmol), 97% red crystals of 4-nitrofluorescein were obtained.C20H11NO7; molecular weight: 377.30; 1HNMR (300 MHz, DMSO-d6)δ 10.20 (brs, 2H, OH), 8.65 (s, 1H, nsi-4H), 8.57 (d, J=8.4. 1H, nsi-6H), 7.57 (d, J=8.3, 1H, nsi-7H), 6.70-6.64 (m, 4H, xa-4, 5, 2, 7H), 6.56 (d, J=8.7, 2H, xa-1, 8H). esims: 376.1 [M-H+] (100).
|
| | 4-Nitrofluorescein Preparation Products And Raw materials |
|