|
|
| | 7,8-DIHYDROXY-4-METHYLCOUMARIN Basic information |
| Product Name: | 7,8-DIHYDROXY-4-METHYLCOUMARIN | | Synonyms: | 7,8-dihydroxy-4-methyl-2h-1-benzopyran-2-on;7,8-dihydroxy-4-methyl-2h-1-benzopyran-2-one;7,8-dihydroxy-4-methyl-coumari;4-METHYL-7,8-DIHYDROXYCOUMARIN;4-METHYLDAPHENETIN;4-METHYLDAPHNETIN;7,8-DIHYDROXY-4-METHYL-2H-CHROMEN-2-ONE;7,8-DIHYDROXY-4-METHYLCOUMARIN | | CAS: | 2107-77-9 | | MF: | C10H8O4 | | MW: | 192.17 | | EINECS: | 218-290-4 | | Product Categories: | Coumarins;API intermediates | | Mol File: | 2107-77-9.mol |  |
| | 7,8-DIHYDROXY-4-METHYLCOUMARIN Chemical Properties |
| Melting point | 242-246 °C (lit.) | | Boiling point | 421.5±45.0 °C(Predicted) | | density | 1.456±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in DMSO | | form | powder to crystal | | pka | 7.72±0.20(Predicted) | | color | White to Light yellow to Light orange | | Sensitive | Light Sensitive | | λmax | 325nm(MeOH)(lit.) | | BRN | 177613 | | InChI | 1S/C10H8O4/c1-5-4-8(12)14-10-6(5)2-3-7(11)9(10)13/h2-4,11,13H,1H3 | | InChIKey | NWQBYMPNIJXFNQ-UHFFFAOYSA-N | | SMILES | CC1=CC(=O)Oc2c(O)c(O)ccc12 | | CAS DataBase Reference | 2107-77-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36-43 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | RTECS | GN6385000 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Resp. Sens. 1 |
| | 7,8-DIHYDROXY-4-METHYLCOUMARIN Usage And Synthesis |
| Chemical Properties | Solid | | Uses | Can be used as a fluorescent sensor to monitor the consumption of a boronic acid in a Suzuki cross-coupling reaction. Use a long wave UV lamp. | | Definition | ChEBI: 7,8-dihydroxy-4-methyl-1-benzopyran-2-one is a hydroxycoumarin. |
| | 7,8-DIHYDROXY-4-METHYLCOUMARIN Preparation Products And Raw materials |
|