|
|
| | ACID BLUE 1 Basic information |
| Product Name: | ACID BLUE 1 | | Synonyms: | KITON PURE BLUE L;KITON PURE BLUE V;LISSAMINE TURQUOISE VN;AZURE BLUE VX;BRILLIANT ACID BLUE;HIDACID AZURE BLUE;HIDACID BLUE V;ERIOGLAUCINE SUPRA | | CAS: | 20262-76-4 | | MF: | C27H31N2O7S2.Na | | MW: | 582.67 | | EINECS: | 243-654-4 | | Product Categories: | | | Mol File: | 20262-76-4.mol |  |
| | ACID BLUE 1 Chemical Properties |
| Melting point | 290 °C (dec.)(lit.) | | Boiling point | 300℃[at 101 325 Pa] | | density | 1.313[at 20℃] | | vapor pressure | 0Pa at 25℃ | | storage temp. | -20°C Freezer | | solubility | DMSO (Sparingly), Methanol (Slightly) | | form | Crystalline Powder | | Colour Index | 42051 | | color | Dark green-blue | | Water Solubility | 9.46-66.68g/L at 20-25℃ | | BRN | 4108121 | | Major Application | diagnostic assay manufacturing hematology histology | | InChIKey | PMLFOMWMYRKZRF-UHFFFAOYSA-M | | SMILES | [Na+].CCN(CC)c1ccc(cc1)\C(=C2/C=CC(\C=C2)=[N+](\CC)CC)c3cc(O)c(cc3S([O-])(=O)=O)S([O-])(=O)=O | | LogP | -3.62--2.31 at 24-25℃ |
| WGK Germany | 3 | | RTECS | BQ4550000 | | HS Code | 34021200 | | Storage Class | 11 - Combustible Solids |
| | ACID BLUE 1 Usage And Synthesis |
| Chemical Properties | dark green-blue crystalline powder | | Uses | Acid Blue 3 Sodium Salt is an synthetic food dye that is banned in Australia and the USA due to reoccurring allergic reactions. | | Uses | lymphangiography and sentinel node biopsy as a dye to color lymph vessels | | Uses | Patent blue V sodium salt is a pH dependent dye. It can also be used in technical or engineered material use for preparation of metal cation exchanged cellulose as new layer material for identification and separation of organic dyes. | | Flammability and Explosibility | Not classified | | Properties and Applications | bright blue. Soluble in water for blue, slightly soluble in ethanol for green light blue. The strong sulfuric acid for brown-olive yellow, yellow for deep diluted, and then to green. Dyes to join sodium hydroxide solution of the same color, heat into deep purple. And C.I. Acid blue 3the same chemical structure, different salt ions. |
| | ACID BLUE 1 Preparation Products And Raw materials |
|