4-METHYL-3-NITROBENZALDEHYDE manufacturers
|
| | 4-METHYL-3-NITROBENZALDEHYDE Basic information |
| | 4-METHYL-3-NITROBENZALDEHYDE Chemical Properties |
| Melting point | 46-49 °C (lit.) | | Boiling point | 276℃ | | density | 1.278 | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | Appearance | Off-white to yellow Solid | | Water Solubility | Insoluble in water. | | Sensitive | Air Sensitive | | BRN | 1637706 | | InChI | 1S/C8H7NO3/c1-6-2-3-7(5-10)4-8(6)9(11)12/h2-5H,1H3 | | InChIKey | KHWGAWBXQOKXIJ-UHFFFAOYSA-N | | SMILES | Cc1ccc(C=O)cc1[N+]([O-])=O | | CAS DataBase Reference | 31680-07-6(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39-37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29130000 | | Storage Class | 11 - Combustible Solids |
| | 4-METHYL-3-NITROBENZALDEHYDE Usage And Synthesis |
| Chemical Properties | Yellow crystalline powder | | Uses | 4-Methyl-3-nitrobenzaldehyde is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff. |
| | 4-METHYL-3-NITROBENZALDEHYDE Preparation Products And Raw materials |
|