|
|
| | 3,4,5-Trifluorobenzoic acid Basic information |
| Product Name: | 3,4,5-Trifluorobenzoic acid | | Synonyms: | 3,4,5-TRIFLUOROBENZOIC ACID;3-flurobenzenenitrile;3,4,5-Trifluorobenzoic;3,4,5-Trifluorobenzoic acid 98%;3,4,5-Trifluorobenzoicacid98%;BUTTPARK 30\01-46;RARECHEM AL BO 0682;Benzoic acid, 3,4,5-trifluoro- | | CAS: | 121602-93-5 | | MF: | C7H3F3O2 | | MW: | 176.09 | | EINECS: | 624-063-4 | | Product Categories: | Fluorine series;C7;Carbonyl Compounds;Carboxylic Acids;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Aromatic Nitriles;Benzoic acid;Fluorobenzoic acids | | Mol File: | 121602-93-5.mol |  |
| | 3,4,5-Trifluorobenzoic acid Chemical Properties |
| Melting point | 97-99 °C (lit.) | | Boiling point | 116-118C/100Torr | | density | 1,12g/cm | | refractive index | 1,471-1,473 | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 3.46±0.10(Predicted) | | color | White to Almost white | | BRN | 7476737 | | InChI | InChI=1S/C7H3F3O2/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2H,(H,11,12) | | InChIKey | VJMYKESYFHYUEQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(F)=C(F)C(F)=C1 | | CAS DataBase Reference | 121602-93-5(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 3,4,5-trifluoro- (121602-93-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29163990 |
| | 3,4,5-Trifluorobenzoic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 3,4,5-Trifluorobenzoic acid is an isomer of 2,3,6-Trifluorobenzoic acid (T790050), and both are deriatives of Benzoic acid (B203900). 3,4,5-Trifluorobenzoic acid is also part of a group of compounds that have potential inhibitory activity towards d-amino acid oxidases, deeming them capable of treating mental disorders such as schizophrenia. | | Uses | 3,4,5-Trifluorobenzoic acid may be used in chemical synthesis. |
| | 3,4,5-Trifluorobenzoic acid Preparation Products And Raw materials |
|