- 4-Methoxyphenylboronic acid
-
- $34.00 / 1kg
-
2025-09-25
- CAS:5720-09-0
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 4-Methoxyphenylboronic acid Basic information |
| | 4-Methoxyphenylboronic acid Chemical Properties |
| Melting point | 204-206 °C(lit.) | | Boiling point | 306.8±44.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in dimethyl sulfoxide and methanol. | | form | Crystalline Powder | | pka | 8.96±0.10(Predicted) | | color | White to light beige | | BRN | 2936912 | | InChI | InChI=1S/C7H9BO3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5,9-10H,1H3 | | InChIKey | VOAAEKKFGLPLLU-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(OC)C=C1)(O)O | | CAS DataBase Reference | 5720-07-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | RTECS | CY8975000 | | TSCA | No | | HazardClass | IRRITANT | | HS Code | 29310095 |
| | 4-Methoxyphenylboronic acid Usage And Synthesis |
| Chemical Properties | white to light beige crystalline powder | | Uses | 4-Methoxyphenylboronic acid can be used as a common organic reagent in Suzuki coupling reactions to study the N-arylation of imidazoles and amines catalyzed by copper exchange of calcium fluorophosphates.Reagent used in the preparation of various biological inhibitors. | | Uses | 4-Methoxyphenylboronic acid is a reagent used for
Suzuki-Miyaura cross-coupling reactions
Pd-catalyzed direct arylation
Highly effective synthesis using palladium-catalyzed arylation Suzuki-Miyaura cross-coupling in water
Palladium-catalyzed stereoselective Heck-type reaction
Tandem-type Pd(II)-catalyzed oxidative Heck reaction and intramolecular C-H amidation sequence
Copper-mediated ligandless aerobic fluoroalkylation of arylboronic acids with fluoroalkyl iodides
Ruthenium catalyzed direct arylation
Rh-catalyzed asymmetric conjugate addition | | Uses | 4-Methoxylphenylboronic Acid is a phenylboronic acid used to investigate boron function in plants. | | Uses | suzuki reaction |
| | 4-Methoxyphenylboronic acid Preparation Products And Raw materials |
|