3-Bromo-2-(bromomethyl)propionic acid manufacturers
|
| | 3-Bromo-2-(bromomethyl)propionic acid Basic information |
| | 3-Bromo-2-(bromomethyl)propionic acid Chemical Properties |
| Melting point | 98-101 °C(lit.) | | Boiling point | 286.7±30.0 °C(Predicted) | | density | 2.121±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Soluble in acetic acid. | | pka | 3.33±0.11(Predicted) | | form | Crystalline Powder | | color | Off-white to brown | | BRN | 1752505 | | InChI | InChI=1S/C4H6Br2O2/c5-1-3(2-6)4(7)8/h3H,1-2H2,(H,7,8) | | InChIKey | QQZJWQCLWOQDQV-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(CBr)CBr | | CAS DataBase Reference | 41459-42-1(CAS DataBase Reference) | | NIST Chemistry Reference | Propionic acid, 3-bromo-2-(bromomethyl)-(41459-42-1) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 8 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29159000 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 3-Bromo-2-(bromomethyl)propionic acid Usage And Synthesis |
| Chemical Properties | off-white to brown crystalline powder | | Uses | 3-Bromo-2-(bromomethyl)propionic acid acts as an organic building block for the preparation of beta-substituted acrylates. It is used in the preparation of t-butyl 2-(phenylthiomethyl) propenoate, t-butyl 3-(phenylthio)-2-(phenylthiomethyl)propenoate and 3-(phenylthio)-2-(phenyl-sulfinylmethyl)propenoate. Further, it plays an important role in the synthesis of beta-lactams by cyclization of the corresponding amide. | | General Description | 3-Bromo-2-(bromomethyl)propionic acid reacts with alkaline arsenite to yield (RS)-3-arsono-2-(hydroxymethyl)propionic acid. | | Synthesis | A mixture of commercially available diethyl bis(hydroxymethyl)malonate (25 g., 0.11 mol.) and a 48%
aqueous hydrogen bromide solution (192 cm3, 1.70 mol) was heated until the ethyl bromide liquid began to evaporate from the mixture and then vigorously distilled for about 1 h.
The reaction mixture was refluxed at 140C for 5 hours. The solution is cooled in an ice bath for 1. 5 hours. The crystals formed were filtered, washed with a small amount of ice-cold water and dried under vacuum. About 80 cm3 was distilled out of the
of the filtrate, the solution was cooled in ice to produce another batch of crystals, washed and dried as before to give 3-bromo-2-bromomethylpropionic acid. |
| | 3-Bromo-2-(bromomethyl)propionic acid Preparation Products And Raw materials |
|