- 1,3-Dibromo-5-nitrobenzene
-
- $200.00 / 1KG
-
2025-09-25
- CAS:6311-60-0
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
|
| | 3,5-DIBROMONITRO BENZENE Basic information | | Uses |
| Product Name: | 3,5-DIBROMONITRO BENZENE | | Synonyms: | 3,5-DIBROMONITRO BENZENE;1,3-Dibromo-5-nitrobenzene;1,3-Dibromo-5-nitrobenzene 97%;3,5-Dibromonitrobenzene 97%;1,3-DibroMo-5-nitrobenzene, 98%, 98%;Benzene, 1,3-dibromo-5-nitro-;6311-60-0 3,5-DIBROMONITRO BENZENE;3,5-Dibromo-1-nitrobenzene | | CAS: | 6311-60-0 | | MF: | C6H3Br2NO2 | | MW: | 280.9 | | EINECS: | | | Product Categories: | blocks;Bromides;NitroCompounds | | Mol File: | 6311-60-0.mol |  |
| | 3,5-DIBROMONITRO BENZENE Chemical Properties |
| Melting point | 103.0 to 107.0 °C | | Boiling point | 290.5°C (rough estimate) | | density | 2.2414 (rough estimate) | | refractive index | 1.6400 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Yellow to Orange | | λmax | 260nm(Cyclohexane)(lit.) | | InChI | InChI=1S/C6H3Br2NO2/c7-4-1-5(8)3-6(2-4)9(10)11/h1-3H | | InChIKey | ZWBHGBWABMAWOV-UHFFFAOYSA-N | | SMILES | C1(Br)=CC([N+]([O-])=O)=CC(Br)=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 36/37/39 | | Hazard Note | Irritant | | HS Code | 29349990 |
| | 3,5-DIBROMONITRO BENZENE Usage And Synthesis |
| Uses | 1,3-Dibromo-5-nitrobenzene is used as an intermediate in pharmaceuticals, organic materials, and OLED materials. |
| | 3,5-DIBROMONITRO BENZENE Preparation Products And Raw materials |
|