|
|
| | METHYL 3-OXOCYCLOBUTANECARBOXYLATE Basic information |
| Product Name: | METHYL 3-OXOCYCLOBUTANECARBOXYLATE | | Synonyms: | METHYL 3-OXOCYCLOBUTANECARBOXYLATE;3-methoxycarbonylcyclobutanone;Methyl 3-oxo-cyclobutanec...;Cyclobutanecarboxylic acid, 3-oxo-, Methyl ester;Methyl 3-oxocyclobutan-1-carboxylate;Carboplatin 10;3-Oxo-cyclobutanecarboxylic acid methyl ester;methyl 3-oxocyclobutane-1-carboxylate | | CAS: | 695-95-4 | | MF: | C6H8O3 | | MW: | 128.13 | | EINECS: | | | Product Categories: | | | Mol File: | 695-95-4.mol |  |
| | METHYL 3-OXOCYCLOBUTANECARBOXYLATE Chemical Properties |
| Boiling point | 188.0±33.0 °C(Predicted) | | density | 1.219g/ml | | storage temp. | 2-8°C | | form | liquid | | color | Colourless | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C6H8O3/c1-9-6(8)4-2-5(7)3-4/h4H,2-3H2,1H3 | | InChIKey | IHLHSAIBOSSHQV-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)CC(=O)C1 |
| | METHYL 3-OXOCYCLOBUTANECARBOXYLATE Usage And Synthesis |
| Uses | Methyl 3-oxocyclobutanecarboxylate can be used as an intermediate for the synthesis of various pharmaceutical compounds. It is used for the preparation of novel imidazobenzazepine derivatives as dual H1/5-HT2A antagonists for the treatment of sleep disorders. | | Synthesis | Concentrated sulfuric acid (0.2 mL) was slowly added dropwise to a solution of 3-oxocyclobutanecarboxylic acid (1 g, 8.77 mmol) in methanol (appropriate amount), followed by heating and refluxing the reaction mixture at 75 °C. The reaction progress was monitored by thin layer chromatography (TLC) and after complete conversion of the feedstock, saturated sodium bicarbonate solution was added to the reaction solution to quench the reaction. The solvent methanol was removed by distillation under reduced pressure and the resulting residue was separated by extraction with ethyl acetate and water. The organic phase was dried over anhydrous sodium sulfate and concentrated under reduced pressure to give methyl 3-oxocyclobutanecarboxylate (1.1 g, 99% yield) as a colorless oil.1H NMR (400 MHz, CDCl3) δ 3.22-3.34 (m, 3H), 3.40-3.47 (m, 2H), 3.78 (s, 3H). | | References | [1] Patent: EP3235819, 2017, A1. Location in patent: Paragraph 0213; 0214
[2] Patent: WO2011/6621, 2011, A1. Location in patent: Page/Page column 36
[3] Patent: WO2017/48675, 2017, A1. Location in patent: Paragraph 0479
[4] Patent: CN104402754, 2016, B. Location in patent: Paragraph 0187; 0188
[5] Patent: CN104447583, 2016, B. Location in patent: Paragraph 0135; 0136; 0137; 0138; 0139 |
| | METHYL 3-OXOCYCLOBUTANECARBOXYLATE Preparation Products And Raw materials |
|