| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:1-Diphenylphosphoryl-1′-diphenylphosphinoferrocene
|
| Company Name: |
AlliChem, LLC
|
| Tel: |
301-317-5072 |
| Email: |
sales@allichemllc.com |
| Products Intro: |
|
| Company Name: |
Leancare Ltd.
|
| Tel: |
+33 962096793 |
| Email: |
enquiry@leancare.co.uk |
| Products Intro: |
|
|
| | 4,5,7-TRIFLUORO-2-METHYLBENZOTHIAZOLE Basic information |
| Product Name: | 4,5,7-TRIFLUORO-2-METHYLBENZOTHIAZOLE | | Synonyms: | 4,5,7-TRIFLUORO-2-METHYLBENZOTHIAZOLE;4,5,7-Trifluoro-2-methylbenzo[d]thiazole;1-Diphenylphosphoryl-1′-diphenylphosphinoferrocene | | CAS: | | | MF: | C8H4F3NS | | MW: | 203.1842696 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 4,5,7-TRIFLUORO-2-METHYLBENZOTHIAZOLE Chemical Properties |
| form | solid | | InChI | 1S/C8H4F3NS/c1-3-12-7-6(11)4(9)2-5(10)8(7)13-3/h2H,1H3 | | InChIKey | MQLYXCLFKUAMQJ-UHFFFAOYSA-N | | SMILES | Fc1c2[s]c(nc2c(c(c1)F)F)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4,5,7-TRIFLUORO-2-METHYLBENZOTHIAZOLE Usage And Synthesis |
| | 4,5,7-TRIFLUORO-2-METHYLBENZOTHIAZOLE Preparation Products And Raw materials |
|