| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
|
| | 1H-Pyrazol-5-ol, 1-(1-methylethyl)-3-(trifluoromethyl)- Basic information |
| | 1H-Pyrazol-5-ol, 1-(1-methylethyl)-3-(trifluoromethyl)- Chemical Properties |
| Boiling point | 238.1±35.0 °C(Predicted) | | density | 1.36±0.1 g/cm3(Predicted) | | form | solid | | pka | 8.25±0.28(Predicted) | | InChI | 1S/C7H9F3N2O/c1-4(2)12-6(13)3-5(11-12)7(8,9)10/h3-4,13H,1-2H3 | | InChIKey | UYAJEUUVECNSPN-UHFFFAOYSA-N | | SMILES | FC(F)(C1=NN(C(C)C)C(O)=C1)F |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 |
| | 1H-Pyrazol-5-ol, 1-(1-methylethyl)-3-(trifluoromethyl)- Usage And Synthesis |
| | 1H-Pyrazol-5-ol, 1-(1-methylethyl)-3-(trifluoromethyl)- Preparation Products And Raw materials |
|