|
|
| | BETA-SECRETASE INHIBITOR IV Basic information |
| Product Name: | BETA-SECRETASE INHIBITOR IV | | Synonyms: | BETA-SECRETASE INHIBITOR IV;1,3-BENZENEDICARBOXAMIDE, N1-[(1S,2R)-3-(CYCLOPROPYLAMINO)-2-HYDROXY-1-(PHENYLMETHYL)PROPYL]-5-[METHYL(METHYLSULFONYL)AMINO]-N3-[(1R)-1-PHENYLETHYL]-;N1-((2S,3R)-4-(cyclopropylamino)-3-hydroxy-1-phenylbutan-2-yl)-5-(N-methylmethylsulfonamido)-N3-((R)-1-phenylethyl)isophthalamide;β-Secretase Inhibitor IV;3-N-[(2S,3R)-4-(cyclopropylamino)-3-hydroxy-1-phenylbutan-2-yl]-5-[methyl(methylsulfonyl)amino]-1-N-[(1R)-1-phenylethyl]benzene-1,3-dicarboxamide;N-((1S,2R)-1-BENZYL-3-CYCLOPROPYLAMINO-2-HYDROXY-PROPYL)-5-(METHANESULFONYL-METHYL-AMINO)-N'-((R)-1-PHENYL-ETHYL)-ISOPHTHALAMIDE;BACE-1 inhibitor;γ-Secretase Inhibitor IV | | CAS: | 797035-11-1 | | MF: | C31H38N4O5S | | MW: | 578.72 | | EINECS: | | | Product Categories: | Human β-secretase (BACE-1) inhibitor. | | Mol File: | 797035-11-1.mol |  |
| | BETA-SECRETASE INHIBITOR IV Chemical Properties |
| density | 1.30±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMF: 20 mg/ml; DMSO: 20 mg/ml; Ethanol: 10 mg/ml | | form | A crystalline solid | | pka | 13.72±0.46(Predicted) | | color | Off-white to light yellow | | InChIKey | VPNIQGRFZCTBEZ-SPTGULJVSA-N | | SMILES | O=C(C1=CC(C(N[C@@H](CC2=CC=CC=C2)[C@H](O)CNC3CC3)=O)=CC(N(S(C)(=O)=O)C)=C1)N[C@H](C)C4=CC=CC=C4 |
| WGK Germany | WGK 1 | | Storage Class | 10 - Combustible liquids |
| | BETA-SECRETASE INHIBITOR IV Usage And Synthesis |
| Uses | beta-Secretase Inhibitor IV is a compound that binds to the active site of BACE-1 and potently blocks its proteolytic activity. | | Biological Activity | Cell permeable: yes', 'Primary Target
β-Secretase', 'Reversible: yes', 'Target IC50: 15 nM for BACE-1, human and 29 nM for sAPP_NF in HEK293-APPNFEV cells |
| | BETA-SECRETASE INHIBITOR IV Preparation Products And Raw materials |
|