|
|
| | 2-Chloro-5-methylpyrazine Basic information |
| Product Name: | 2-Chloro-5-methylpyrazine | | Synonyms: | C90111;2-Chloro-5-methyl-1,4-diazine;Pyrazine,2-chloro-5-Methyl-;2-CHLORO-5-METHYLPYRAZINE;2-Chloro-5-methylpyrazine 97% | | CAS: | 59303-10-5 | | MF: | C5H5ClN2 | | MW: | 128.56 | | EINECS: | | | Product Categories: | | | Mol File: | 59303-10-5.mol |  |
| | 2-Chloro-5-methylpyrazine Chemical Properties |
| Boiling point | 172℃ | | density | 1.234 | | Fp | 72℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -0.31±0.10(Predicted) | | form | liquid | | color | Colourless | | InChI | InChI=1S/C5H5ClN2/c1-4-2-8-5(6)3-7-4/h2-3H,1H3 | | InChIKey | XSDAJECCWPYVGW-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=C(C)N=C1 |
| | 2-Chloro-5-methylpyrazine Usage And Synthesis |
| | 2-Chloro-5-methylpyrazine Preparation Products And Raw materials |
|