|
|
| | 1-Imidazol-1-ylmethyl-2,2-dimethyl-propylamine dihydrochloride Basic information |
| | 1-Imidazol-1-ylmethyl-2,2-dimethyl-propylamine dihydrochloride Chemical Properties |
| form | solid | | InChI | 1S/C9H17N3.2ClH/c1-9(2,3)8(10)6-12-5-4-11-7-12;;/h4-5,7-8H,6,10H2,1-3H3;2*1H | | InChIKey | IBNJOMVWUURIJE-UHFFFAOYSA-N | | SMILES | NC(C(C)(C)C)CN1C=NC=C1.[H]Cl.[H]Cl |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| | 1-Imidazol-1-ylmethyl-2,2-dimethyl-propylamine dihydrochloride Usage And Synthesis |
| | 1-Imidazol-1-ylmethyl-2,2-dimethyl-propylamine dihydrochloride Preparation Products And Raw materials |
|