Triformylmethane manufacturers
- Triformylmethane
-
- $1.00
-
2020-01-08
- CAS:18655-47-5
- Min. Order: 1KG
- Purity: 98%HPLC
- Supply Ability: 10 tons/month
|
| | Triformylmethane Basic information |
| Product Name: | Triformylmethane | | Synonyms: | 2-FORMYL-MALONALDEHYDE;Methanetricarbaldehyde;Triformylmethane;3-Formylmalondialdehyde;Methanetricarboxaldehyde;2,3-dioxobutanedial hydrate;2-Formyl-maloldehyde;2-(hydroxymethylene)malonaldehyde | | CAS: | 18655-47-5 | | MF: | C4H4O3 | | MW: | 100.07 | | EINECS: | | | Product Categories: | Aliphatic Compound | | Mol File: | 18655-47-5.mol |  |
| | Triformylmethane Chemical Properties |
| Melting point | 102.5-103.5 °C (sublm) | | Boiling point | 131 °C | | density | 1.151 | | Fp | 32 °C | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 1.54±0.59(Predicted) | | InChI | InChI=1S/C4H4O3/c5-1-4(2-6)3-7/h1-4H | | InChIKey | WRWNFZAKUHZONV-UHFFFAOYSA-N | | SMILES | C(C=O)(C=O)C=O |
| | Triformylmethane Usage And Synthesis |
| | Triformylmethane Preparation Products And Raw materials |
|