|
|
| | 2-Cyclopropyl-4-(4-fluorophenyl)quinoline-3-carboxaldehyde Basic information |
| | 2-Cyclopropyl-4-(4-fluorophenyl)quinoline-3-carboxaldehyde Chemical Properties |
| Melting point | 150-152°C | | Boiling point | 453.9±45.0 °C(Predicted) | | density | 1.289±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.69±0.50(Predicted) | | color | Pale Yellow | | InChI | InChI=1S/C19H14FNO/c20-14-9-7-12(8-10-14)18-15-3-1-2-4-17(15)21-19(13-5-6-13)16(18)11-22/h1-4,7-11,13H,5-6H2 | | InChIKey | JAHBIRPTCXOGLB-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=CC=2)C(C2=CC=C(F)C=C2)=C(C=O)C=1C1CC1 | | CAS DataBase Reference | 121660-37-5(CAS DataBase Reference) |
| | 2-Cyclopropyl-4-(4-fluorophenyl)quinoline-3-carboxaldehyde Usage And Synthesis |
| Uses | 2-Cyclopropyl-4-(4-fluorophenyl)quinoline-3-carbaldehyde is an intermediate used in the synthesis of NK-104. |
| | 2-Cyclopropyl-4-(4-fluorophenyl)quinoline-3-carboxaldehyde Preparation Products And Raw materials |
|