- Fmoc-L-Phg-OH
-
-
2026-06-12
- CAS:102410-65-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- Fmoc-L-phenylglycine
-
- $7.00
-
2019-07-06
- CAS: 102410-65-1
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100KG
|
| | Fmoc-L-phenylglycine Basic information |
| | Fmoc-L-phenylglycine Chemical Properties |
| Melting point | 175-180 °C | | alpha | 81 º (c=1% in DMF) | | Boiling point | 606.3±50.0 °C(Predicted) | | density | 1.299±0.06 g/cm3(Predicted) | | refractive index | 81 ° (C=1, DMF) | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | pka | 3.39±0.10(Predicted) | | form | Solid | | color | White to Almost white | | Optical Rotation | [α]20/D +81±3°, c = 1% in DMF | | BRN | 5309005 | | Major Application | peptide synthesis | | InChI | 1S/C23H19NO4/c25-22(26)21(15-8-2-1-3-9-15)24-23(27)28-14-20-18-12-6-4-10-16(18)17-11-5-7-13-19(17)20/h1-13,20-21H,14H2,(H,24,27)(H,25,26)/t21-/m0/s1 | | InChIKey | PCJHOCNJLMFYCV-NRFANRHFSA-N | | SMILES | OC(=O)[C@@H](NC(=O)OCC1c2ccccc2-c3ccccc13)c4ccccc4 | | CAS DataBase Reference | 102410-65-1(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | HS Code | 2924 29 70 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | Fmoc-L-phenylglycine Usage And Synthesis |
| Chemical Properties | Solid | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-L-phenylglycine Preparation Products And Raw materials |
|