|
|
| | Ethacridine lactate monohydrate Basic information |
| | Ethacridine lactate monohydrate Chemical Properties |
| Melting point | 243-245 °C(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Sparingly soluble in water, very slightly soluble in ethanol (96 per cent), practically insoluble in methylene chloride. | | form | Powder | | color | Yellow | | Merck | 14,3716 | | BRN | 3642805 | | Stability: | Hygroscopic | | InChI | InChI=1S/C15H15N3O.C3H6O3/c1-2-19-10-4-6-13-12(8-10)15(17)11-5-3-9(16)7-14(11)18-13;1-2(4)3(5)6/h3-8H,2,16H2,1H3,(H2,17,18);2,4H,1H3,(H,5,6) | | InChIKey | IYLLULUTZPKQBW-UHFFFAOYSA-N | | SMILES | C(O)(C)C(=O)O.NC1C2=CC=C(N)C=C2N=C2C=CC(OCC)=CC=12 | | CAS DataBase Reference | 6402-23-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | OD4725000 | | HS Code | 29339980 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 | | Toxicity | LD50 s.c. in mice: 0.12 g/kg (Rubbo) |
| | Ethacridine lactate monohydrate Usage And Synthesis |
| Chemical Properties | yellow powder | | Uses | antiseptic, abortifaceant | | Uses | Reagent in serological testing and protein chemistry. | | Uses | Ethacridine Lactate Monohydrate is an antiseptic agent that makes an effective abortifacient. | | Purification Methods | It forms yellow crystals from 90% EtOH/Et2O. Its solubility in H2O is ~15% at 25o and ~9% at 100o, and its solutions have a yellow fluorescence which is stable on boiling. It is an antiseptic. See ethacridine above, Beilstein 22 II 458, 22 III/IV 6680, 22/12 V 243.] |
| | Ethacridine lactate monohydrate Preparation Products And Raw materials |
|