|
|
| | trans-4-Dimethylaminocrotonic acid hydrochloride Basic information |
| | trans-4-Dimethylaminocrotonic acid hydrochloride Chemical Properties |
| Melting point | 162 °C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C6H11NO2.ClH/c1-7(2)5-3-4-6(8)9;/h3-4H,5H2,1-2H3,(H,8,9);1H/b4-3+; | | InChIKey | UUHNQHFOIVLAQX-BJILWQEISA-N | | SMILES | C(/CN(C)C)=C\C(=O)O.Cl | | CAS DataBase Reference | 848133-35-7(CAS DataBase Reference) |
| | trans-4-Dimethylaminocrotonic acid hydrochloride Usage And Synthesis |
| Description | trans-4-Dimethylaminocrotonic acid hydrochloride is a very important pharmaceutical intermediate and is an essential part of the structure of the anti-tumour drugs afatinib and neratinib. It is also an important organic synthesis reagent for the preparation of novel pyrazole derivatives and 6-heterocycloalkyl quinazoline derivatives. | | Chemical Properties | White Solid | | Uses | trans 4-Dimethylaminocrotonic acid HCl is a reagent used in the preparation of tyrosine kinase inhibiting antitumor agents. | | Synthesis | trans-4-Dimethylaminocrotonic acid hydrochloride is synthesised using (E)-4-(dimethylamino)-2-butenoic acid methyl ester as a raw material by adding reagents such as water, sodium hydroxide, methanol, and hydrogen chloride through a chemical reaction.
 |
| | trans-4-Dimethylaminocrotonic acid hydrochloride Preparation Products And Raw materials |
|