|
|
| | Zirconium naphthenate Basic information |
| Product Name: | Zirconium naphthenate | | Synonyms: | zirconium naphthenate;Naphthenic acids, zirconium salts;Zirconium naphthenate ISO 9001：2015 REACH;Zirconium naphthenate 98% | | CAS: | 72854-21-8 | | MF: | C44H28O8Zr | | MW: | 775.921 | | EINECS: | 276-943-9 | | Product Categories: | | | Mol File: | 72854-21-8.mol |  |
| | Zirconium naphthenate Chemical Properties |
| InChI | InChI=1S/4C11H8O2.Zr/c4*12-11(13)10-7-3-5-8-4-1-2-6-9(8)10;/h4*1-7H,(H,12,13);/q;;;;+4/p-4 | | InChIKey | YFBCIWLMUBBGBE-UHFFFAOYSA-J | | SMILES | [Zr](OC(=O)C1=CC=CC2C=CC=CC1=2)(OC(=O)C1=CC=CC2C=CC=CC1=2)(OC(=O)C1=CC=CC2C=CC=CC1=2)OC(=O)C1=CC=CC2C=CC=CC1=2 | | EPA Substance Registry System | Zirconium naphthenates (72854-21-8) |
| | Zirconium naphthenate Usage And Synthesis |
| Chemical Properties | Amber-colored, heavy, transparent liquid.
Viscosity equivalent to that of heavy
lubricating oil. Very stable, unlike other metallic naphthenates, possesses no drying properties. Soluble
in all common solvents. Combustible. | | Uses | Ceramics (enamels, glazes); lubricants; paints
and varnishes (antichalking agent, minimizer of
moisture and solar radiation effects). |
| | Zirconium naphthenate Preparation Products And Raw materials |
|