- cis-BBD
-
- $59.00 / 500mg
-
2026-04-14
- CAS:61397-56-6
- Min. Order:
- Purity: 99.91%
- Supply Ability: 10g
|
| | cis-2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane-4-ylmethyl benzoate Basic information |
| Product Name: | cis-2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane-4-ylmethyl benzoate | | Synonyms: | CIS-BBD;Cis-[(2-Bromomethyl)-2(2,4-Dichlorophenyl)-1,3-Dioxolan-4-Yl] Methyl Benxoate;Cis-bromo-ester(Cis-BBD);CIS -BROMOBENZOATE:CIS -[2-BROMOMETHYL-2-(2,4-DICHLOROPHENYL)-1,3-DIOXOLAN-4-YL]METHYL BENZOATE;CIS-BROMO-ESTER [CIS-2-(2,4-DICHLOROPHENYL)-2-BROMOMETHYL-4-(BENZOYLOXY)-METHYL-1,3-DIOXALANE];CisBromoBenzoateItraconazole;CIS -[2-BROMOMETHYL-2-(2,4-DICHLOROPHENYL)-1,3-DIOXOLAN-4-YL]METHYL BENZOATE /CIS -BROMOBENZOATE;(Z)-2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-ylmethyl benzoate | | CAS: | 61397-56-6 | | MF: | C18H15BrCl2O4 | | MW: | 446.12 | | EINECS: | 262-765-9 | | Product Categories: | Pharmaceutical Intermediates | | Mol File: | 61397-56-6.mol |  |
| | cis-2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane-4-ylmethyl benzoate Chemical Properties |
| Melting point | 116-117 °C(Solv: ethanol (64-17-5)) | | Boiling point | 517.0±50.0 °C(Predicted) | | density | 1.512±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White | | Water Solubility | 12μg/L at 20℃ | | InChI | InChI=1S/C18H15BrCl2O4/c1-23-17(22)13-5-3-2-4-12(13)16-9-24-18(10-19,25-16)14-7-6-11(20)8-15(14)21/h2-8,16H,9-10H2,1H3 | | InChIKey | ALDNTQXBYHYCPK-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=CC=C1C1COC(CBr)(C2=CC=C(Cl)C=C2Cl)O1 | | LogP | 5.8 | | CAS DataBase Reference | 61397-56-6(CAS DataBase Reference) |
| | cis-2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane-4-ylmethyl benzoate Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | cis-[2-Bromomethyl-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl Benzoate is an intermediate in the preparation of antifungal agents such as Ketoconazole (K186000), Itraconazole (I937500) and Tercon
azole. | | Flammability and Explosibility | Not classified |
| | cis-2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane-4-ylmethyl benzoate Preparation Products And Raw materials |
|