|
|
| | (R)-6,8-Dimercaptooctanoic acid Basic information |
| Product Name: | (R)-6,8-Dimercaptooctanoic acid | | Synonyms: | R-(+)-Dihydrolipoic acid;(R)-6,8-Dimercaptooctanoic acid;Octanoic acid, 6,8-dimercapto-, (6R)-;(R)-6,8-Dimercaptooctanoicaci;Lipoic Acid Impurity 32 | | CAS: | 119365-69-4 | | MF: | C8H16O2S2 | | MW: | 208.34 | | EINECS: | | | Product Categories: | | | Mol File: | 119365-69-4.mol |  |
| | (R)-6,8-Dimercaptooctanoic acid Chemical Properties |
| Boiling point | 361°C | | density | 1.134 | | Fp | 172°C | | pka | 4.74±0.10(Predicted) | | InChI | InChI=1S/C8H16O2S2/c9-8(10)4-2-1-3-7(12)5-6-11/h7,11-12H,1-6H2,(H,9,10)/t7-/m1/s1 | | InChIKey | IZFHEQBZOYJLPK-SSDOTTSWSA-N | | SMILES | C(O)(=O)CCCC[C@@H](S)CCS |
| | (R)-6,8-Dimercaptooctanoic acid Usage And Synthesis |
| Uses | (R)-6,8-Dimercaptooctanoic Acid is a useful research chemical used in the preparation of of pharmaceutically active uridine ester nucleosides against a variety of diseases. | | Definition | ChEBI: (R)-dihydrolipoic acid is the (R)-enantiomer and bioactive form of dihydrolipoic acid. It is a conjugate acid of a (R)-dihydrolipoate. It is an enantiomer of a (S)-dihydrolipoic acid. |
| | (R)-6,8-Dimercaptooctanoic acid Preparation Products And Raw materials |
|