| Company Name: |
Aromsyn Co., Ltd. |
| Tel: |
+86-0571-85585865 +86-13336024896 |
| Email: |
CB@aromsyn.com |
|
| | Benzoic acid, 3,5-diiodo-2-methoxy- Basic information | | Uses |
| | Benzoic acid, 3,5-diiodo-2-methoxy- Chemical Properties |
| Melting point | 204 °C | | Boiling point | 441.4±45.0 °C(Predicted) | | density | 2.374±0.06 g/cm3(Predicted) | | pka | 3.39±0.10(Predicted) | | InChI | InChI=1S/C8H6I2O3/c1-13-7-5(8(11)12)2-4(9)3-6(7)10/h2-3H,1H3,(H,11,12) | | InChIKey | HLZOAFKJWZBDPO-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(I)=CC(I)=C1OC |
| | Benzoic acid, 3,5-diiodo-2-methoxy- Usage And Synthesis |
| Uses | 3,5-Diiodo-2-methoxybenzoic acid is a white crystalline solid that can be used to synthesize dyes and pigments, as well as as a coating additive to improve the performance of coatings. |
| | Benzoic acid, 3,5-diiodo-2-methoxy- Preparation Products And Raw materials |
|