|
|
| | O-isopropyl ethylthiocarbamate Basic information |
| Product Name: | O-isopropyl ethylthiocarbamate | | Synonyms: | O-isopropyl ethylthiocarbamate;Carbamothioic acid, ethyl-, O-(1-methylethyl) ester;Ethylthiocarbaminsure-O-isopropylester;ethyl-carbamothioic acid o-(1-methylethyl) ester;N-Ethylthionocarbamic acid O-isopropyl ester;isopropyl ethyl thioncarbamate;CarbaMothioic acid,N-ethyl-, O-(1-Methylethyl) ester;O-propan-2-yl N-ethylcarbamothioate | | CAS: | 141-98-0 | | MF: | C6H13NOS | | MW: | 147.24 | | EINECS: | 205-517-7 | | Product Categories: | Thionocarbamate;Beneficiation Reagent | | Mol File: | 141-98-0.mol |  |
| | O-isopropyl ethylthiocarbamate Chemical Properties |
| Boiling point | 120-122 °C(Press: 0.7 Torr) | | density | 0.9854 g/cm3 | | vapor pressure | 90.7-950Pa at 20-25℃ | | storage temp. | Refrigerator | | solubility | Chloroform (Sparingly), Methanol (Sparingly) | | pka | 14.50±0.70(Predicted) | | form | Oil | | color | Pale Yellow to Light Yellow | | Water Solubility | 114.4-2650mg/L at 25℃ | | InChI | InChI=1S/C6H13NOS/c1-4-7-6(9)8-5(2)3/h5H,4H2,1-3H3,(H,7,9) | | InChIKey | KIACEOHPIRTHMI-UHFFFAOYSA-N | | SMILES | C(=S)(OC(C)C)NCC | | LogP | 2.3-3.32 at 25-30℃ | | EPA Substance Registry System | O-Isopropyl ethylthiocarbamate (141-98-0) |
| | O-isopropyl ethylthiocarbamate Usage And Synthesis |
| Uses | O-Isopropyl Ethylthiocarbamate can be used to analyze illicit liquor using HS-GC-MS. |
| | O-isopropyl ethylthiocarbamate Preparation Products And Raw materials |
|