|
|
| | benzyl 3-hydroxypropionate Basic information |
| | benzyl 3-hydroxypropionate Chemical Properties |
| Boiling point | 315.5±17.0 °C(Predicted) | | density | 1.153±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Oil | | pka | 14.32±0.10(Predicted) | | color | Clear Colourless to Pale Yellow | | InChI | InChI=1S/C10H12O3/c11-7-6-10(12)13-8-9-4-2-1-3-5-9/h1-5,11H,6-8H2 | | InChIKey | RDRDBYYUPACJJT-UHFFFAOYSA-N | | SMILES | C(OCC1=CC=CC=C1)(=O)CCO | | EPA Substance Registry System | Propanoic acid, 3-hydroxy-, phenylmethyl ester (14464-10-9) |
| TSCA | TSCA listed | | HS Code | 2918199890 |
| | benzyl 3-hydroxypropionate Usage And Synthesis |
| Chemical Properties | Pale Yellow Oil | | Uses | Intermediate in the production of Cyclophosphamide metabolites. |
| | benzyl 3-hydroxypropionate Preparation Products And Raw materials |
|