| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
HBCChem, Inc. |
| Tel: |
+1-510-219-6317 |
| Email: |
sales@hbcchem.com |
|
| | 4-Amino-L-phenyl-N-phthalylalanine ethyl ester Basic information |
| Product Name: | 4-Amino-L-phenyl-N-phthalylalanine ethyl ester | | Synonyms: | 4-Amino-L-phenyl-N-phthalylalanine ethyl ester;Ethyl 3-(4-aminophenyl)-2-(1,3-dioxoisoindol-2-yl)propanoate;ethyl (S)-alpha-[(4-aminophenyl)methyl]-1,3-dihydro-1,3-dioxo-2H-isoindole-2-acetate;(L)-ethyl 3-(4-aminophenyl)-2-(1,3-dioxoisoindolin-2-yl)propanoate;(S)-α-[(4-Aminophenyl)methyl]-1,3-dihydro-1,3-dioxo-2H-isoindole-2-acetic acid ethyl ester;3-(4-aminophenyl)-2-(1,3-diketoisoindolin-2-yl)propionic acid ethyl ester;ethyl 3-(4-azanylphenyl)-2-(1,3-dioxoisoindol-2-yl)propanoate;ethyl(S)-α-[(4-aMinophenyl)Methyl]-1,3-dihydro-1,3-dioxo-2H-isoindole-2-acetate | | CAS: | 74743-23-0 | | MF: | C19H18N2O4 | | MW: | 338.36 | | EINECS: | 277-979-8 | | Product Categories: | | | Mol File: | 74743-23-0.mol |  |
| | 4-Amino-L-phenyl-N-phthalylalanine ethyl ester Chemical Properties |
| Melting point | 102-103 °C(Solv: water (7732-18-5); methanol (67-56-1)) | | Boiling point | 534.8±45.0 °C(Predicted) | | density | 1.331±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 4.42±0.10(Predicted) | | InChI | InChI=1/C19H18N2O4/c1-2-25-19(24)16(11-12-7-9-13(20)10-8-12)21-17(22)14-5-3-4-6-15(14)18(21)23/h3-10,16H,2,11,20H2,1H3/t16-/s3 | | InChIKey | RYROTMZMTMCWEP-QEIABERDNA-N | | SMILES | N1([C@@H](CC2=CC=C(N)C=C2)C(OCC)=O)C(=O)C2=C(C=CC=C2)C1=O |&1:1,r| |
| | 4-Amino-L-phenyl-N-phthalylalanine ethyl ester Usage And Synthesis |
| | 4-Amino-L-phenyl-N-phthalylalanine ethyl ester Preparation Products And Raw materials |
|