- Fosfructose
-
- $37.00 / 1mg
-
2025-07-21
- CAS:488-69-7
- Min. Order:
- Purity: 99.84%
- Supply Ability: 10g
|
| | D-fructose 1,6-bis(dihydrogen phosphate) Basic information |
| | D-fructose 1,6-bis(dihydrogen phosphate) Chemical Properties |
| Melting point | 72--74°C | | Boiling point | 819.8±75.0 °C(Predicted) | | density | 2.007±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Methanol (Slightly), Water (Slightly) | | pka | 1?+-.0.10(Predicted) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C6H14O12P2/c7-3(1-17-19(11,12)13)5(9)6(10)4(8)2-18-20(14,15)16/h3,5-7,9-10H,1-2H2,(H2,11,12,13)(H2,14,15,16)/t3-,5-,6-/m1/s1 | | InChIKey | XPYBSIWDXQFNMH-UYFOZJQFSA-N | | SMILES | C(OP(O)(O)=O)C([C@H]([C@@H]([C@@H](COP(O)(O)=O)O)O)O)=O | | EPA Substance Registry System | D-Fructose, 1,6-bis(dihydrogen phosphate) (488-69-7) |
| RIDADR | 1759 | | HazardClass | 8 | | PackingGroup | III |
| | D-fructose 1,6-bis(dihydrogen phosphate) Usage And Synthesis |
| Uses | Cardioprotectant for ischemic disorders. | | Definition | ChEBI: D-fructofuranose 1,6-bisphosphate is the furanose form of D-fructose 1,6-bisphosphate. It is functionally related to a D-fructofuranose. It is a conjugate acid of a D-fructofuranose 1,6-bisphosphate(4-). |
| | D-fructose 1,6-bis(dihydrogen phosphate) Preparation Products And Raw materials |
|