| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
3-(1,1-dimethylethyl)[1,1'-biphenyl]-2-ol manufacturers
|
| | 3-(1,1-dimethylethyl)[1,1'-biphenyl]-2-ol Basic information |
| Product Name: | 3-(1,1-dimethylethyl)[1,1'-biphenyl]-2-ol | | Synonyms: | 3-(1,1-dimethylethyl)[1,1'-biphenyl]-2-ol;3-tert-Butyl-1,1'-biphenyl-2-ol;3-tert-Butylbiphenyl-2-ol;6-tert-butyl-o-Phenylphenol;[1,1'-Biphenyl]-2-ol, 3-(1,1-dimethylethyl)-;2-tert-butyl-6-phenylphenol | | CAS: | 2416-98-0 | | MF: | C16H18O | | MW: | 226.31 | | EINECS: | 219-331-9 | | Product Categories: | | | Mol File: | 2416-98-0.mol | ![3-(1,1-dimethylethyl)[1,1'-biphenyl]-2-ol Structure](CAS/GIF/2416-98-0.gif) |
| | 3-(1,1-dimethylethyl)[1,1'-biphenyl]-2-ol Chemical Properties |
| Boiling point | 327.93°C (rough estimate) | | density | 0.9955 (rough estimate) | | refractive index | 1.4970 (estimate) | | pka | 11.36±0.10(Predicted) | | InChI | InChI=1S/C16H18O/c1-16(2,3)14-11-7-10-13(15(14)17)12-8-5-4-6-9-12/h4-11,17H,1-3H3 | | InChIKey | HXVMQDBXJZKLEV-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=CC=CC(C(C)(C)C)=C1O |
| | 3-(1,1-dimethylethyl)[1,1'-biphenyl]-2-ol Usage And Synthesis |
| | 3-(1,1-dimethylethyl)[1,1'-biphenyl]-2-ol Preparation Products And Raw materials |
|