|
|
| | alpha-phenyl[1,1'-biphenyl]-4-methanol Basic information |
| Product Name: | alpha-phenyl[1,1'-biphenyl]-4-methanol | | Synonyms: | Bifonazole EP Impurity A;A-PHENYL-1,1BIPHENYL-4-METHANOL;4-PHENYLBENZHYDROL;(1,1'-Biphenyl-4-yl)phenylmethanol;Phenyl(biphenyl-4-yl)methanol;α-(4-Biphenylyl)benzyl alcohol;α-Phenyl[1,1'-biphenyl]-4-methanol;α-Phenylbiphenyl-4-methanol | | CAS: | 7598-80-3 | | MF: | C19H16O | | MW: | 260.32974 | | EINECS: | 231-506-1 | | Product Categories: | | | Mol File: | 7598-80-3.mol | ![alpha-phenyl[1,1'-biphenyl]-4-methanol Structure](CAS/GIF/7598-80-3.gif) |
| | alpha-phenyl[1,1'-biphenyl]-4-methanol Chemical Properties |
| Melting point | 95-96 °C | | Boiling point | 258-260 °C(Press: 17 Torr) | | density | 1.120±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly), Toluene (Slightly) | | form | Solid | | pka | 13.45±0.20(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C19H16O/c20-19(17-9-5-2-6-10-17)18-13-11-16(12-14-18)15-7-3-1-4-8-15/h1-14,19-20H | | InChIKey | WMFZVLIHQVUVGO-UHFFFAOYSA-N | | SMILES | C1(C=CC(C(O)C2C=CC=CC=2)=CC=1)C1C=CC=CC=1 |
| | alpha-phenyl[1,1'-biphenyl]-4-methanol Usage And Synthesis |
| Uses | [1,??1'-??Biphenyl]??-??4-??yl(phenyl)??methanol (Bifonazole EP Impurity A) is a Bifonazole (B383400), an anti-fungal agent used in the treatment of skin diseases. Causes an increase in Ca2+ concentration and triggers cell death in PC3 human prostate cancer cells. |
| | alpha-phenyl[1,1'-biphenyl]-4-methanol Preparation Products And Raw materials |
|