Methyl 4-amino-2-methoxy-5-thiocyanobenzoate manufacturers
|
| | Methyl 4-amino-2-methoxy-5-thiocyanobenzoate Basic information |
| | Methyl 4-amino-2-methoxy-5-thiocyanobenzoate Chemical Properties |
| Melting point | 160-165°C | | Boiling point | 422.0±45.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | solubility | Dichloromethane, Ethyl Acetate, Methanol | | form | Solid | | pka | -0.86±0.13(Predicted) | | color | Yellow | | InChI | InChI=1S/C10H10N2O3S/c1-14-8-4-7(12)9(16-5-11)3-6(8)10(13)15-2/h3-4H,12H2,1-2H3 | | InChIKey | IRGMWPMUTWZIIJ-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(SC#N)=C(N)C=C1OC |
| | Methyl 4-amino-2-methoxy-5-thiocyanobenzoate Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | Methyl 4-Amino-2-methoxy-5-thiocyanobenzoate is an Amisulpride (A633250) impurity. |
| | Methyl 4-amino-2-methoxy-5-thiocyanobenzoate Preparation Products And Raw materials |
|