|
|
| | 3-methylthiazolidine-2-thione Basic information |
| | 3-methylthiazolidine-2-thione Chemical Properties |
| Melting point | 68-69 °C | | Boiling point | 90-100 °C(Press: 10-14 Torr) | | density | 1.30±0.1 g/cm3(Predicted) | | vapor pressure | 0.11Pa at 20℃ | | storage temp. | 2-8°C | | pka | 0.81±0.20(Predicted) | | Water Solubility | 3.56g/L at 30℃ | | InChI | InChI=1S/C4H7NS2/c1-5-2-3-7-4(5)6/h2-3H2,1H3 | | InChIKey | RGTLAJIDOSPEDH-UHFFFAOYSA-N | | SMILES | S1CCN(C)C1=S | | LogP | 0.59 at 20.3℃ | | EPA Substance Registry System | 2-Thiazolidinethione, 3-methyl- (1908-87-8) |
| | 3-methylthiazolidine-2-thione Usage And Synthesis |
| Uses | vulcanzing agent for CR |
| | 3-methylthiazolidine-2-thione Preparation Products And Raw materials |
|