|
|
| | 3beta,14,16beta-trihydroxy-5-betacard-20(22)-enolide 16-acetate Basic information |
| Product Name: | 3beta,14,16beta-trihydroxy-5-betacard-20(22)-enolide 16-acetate | | Synonyms: | 16β-Acetoxy-3β,14-dihydroxy-5β,14β-carda-20(22)-enolide;16β-Acetoxy-3β,14-dihydroxy-5β-card-20(22)-enolide;16β-Acetyloxy-3β,14-dihydroxy-5β-card-20(22)-enolide;(3S,5R,8R,9S,10S,13R,14S,16S,17R)-3,14-dihydroxy-10,13-dimethyl-17-(5-oxo-2,5-dihydrofuran-3-yl)hexadecahydro-1H-cyclopenta[a]phenanthren-16-yl acetate;3beta,14,16beta-trihydroxy-5-betacard-20(22)-enolide 16-acetate;Oleandrisenin;Card-20(22)-enolide, 16-(acetyloxy)-3,14-dihydroxy-, (3β,5β,16β)-;0leandrigenin | | CAS: | 465-15-6 | | MF: | C25H36O6 | | MW: | 432.55 | | EINECS: | 207-359-4 | | Product Categories: | | | Mol File: | 465-15-6.mol |  |
| | 3beta,14,16beta-trihydroxy-5-betacard-20(22)-enolide 16-acetate Chemical Properties |
| Melting point | 223 °C | | Boiling point | 584.6±50.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | pka | 14.35±0.70(Predicted) | | InChIKey | IWCNCUVTGOMGKG-LXDPVJNCNA-N | | SMILES | [C@@H]1(O)C[C@]2([H])[C@](C)(CC1)[C@]1([H])[C@]([H])(C3(O)[C@@](CC1)(C)[C@@H](C1=CC(=O)OC1)[C@@H](OC(=O)C)C3)CC2 |&1:0,3,5,9,11,15,19,26,r| |
| | 3beta,14,16beta-trihydroxy-5-betacard-20(22)-enolide 16-acetate Usage And Synthesis |
| Uses | Oleandrigenin is a potent cardiotonic steroid. Oleandrigenin shows Na+/K+-ATP-ase inhibiting and cytotoxic activities[1][2]. | | Definition | ChEBI: A steroid ester that is the 16-acetyl derivative of gitoxigenin. | | References | [1] Fejedelem Z, et al. Synthesis of Cardiotonic Steroids Oleandrigenin and Rhodexin B. J Org Chem. 2021 Aug 6;86(15):10249-10262. DOI:10.1021/acs.joc.1c00985
[2] Michalak K, et al. Synthesis and evaluation of Na+/K+-ATP-ase inhibiting and cytotoxic in vitro activities of oleandrigenin and its selected 17β-(butenolidyl)- and 17β-(3-furyl)- analogues. Eur J Med Chem. 2020 Sep 15;202:112520. DOI:10.1016/j.ejmech.2020.112520 |
| | 3beta,14,16beta-trihydroxy-5-betacard-20(22)-enolide 16-acetate Preparation Products And Raw materials |
|