- Dutasteride Impurity 3
-
- $40.00 / 1kg
-
2025-06-20
- CAS:103335-55-3
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 10 tons
|
| | 3-Oxo-4-aza-5-alpha-androstane-17-beta-carboxylic acid Basic information |
| Product Name: | 3-Oxo-4-aza-5-alpha-androstane-17-beta-carboxylic acid | | Synonyms: | (2R,3R,4BS,6AS,7S,9AS,9BS)-4A,6A-DIMETHYL-2-OXO-HEXADECAHYDRO-INDENO[5,4-F]QUINOLINE-7-CARBOXYLIC ACID;4-aza-5a-androstan-3-one-17carboxylicacid;3-OXO-4-AZA-5-ALPHA-ANDROSTANE-17-BETA-CARBOCYLIC ACID;4-AZA-5A-ANDROSTAN-3-ONE-17B-CARBOXYLIC ACID,MIN98.5%;3-Oxo-4-aza-5-alpha-androstane-17-beta-carboxylic acid;M3-ACID;Finasteride Impurity Ⅰ;(11aR)-4a,6a-dimethyl-2-oxo-hexadecahydro-1H-indeno[5,4-f]quinoline-7-carboxylic acid | | CAS: | 103335-55-3 | | MF: | C19H29NO3 | | MW: | 319.44 | | EINECS: | 407-820-1 | | Product Categories: | | | Mol File: | 103335-55-3.mol |  |
| | 3-Oxo-4-aza-5-alpha-androstane-17-beta-carboxylic acid Chemical Properties |
| Melting point | >308 °C(Solv: acetone (67-64-1)) | | Boiling point | 518.2±50.0 °C(Predicted) | | density | 1.145±0.06 g/cm3(Predicted) | | solubility | DMSO (Sparingly), Methanol (Very Slightly, Heated, Soniciated) | | form | powder to crystal | | pka | 4.81±0.60(Predicted) | | color | White to Light yellow | | Water Solubility | 3.61mg/L | | InChIKey | MJXIPHMGYJXKLJ-MLGOENBGSA-N | | SMILES | N1[C@@]2([H])[C@@](C)([C@@]3([H])CC[C@@]4(C)[C@]([H])([C@]3([H])CC2)CC[C@@H]4C(O)=O)CCC1=O | | LogP | 1.92 |
| | 3-Oxo-4-aza-5-alpha-androstane-17-beta-carboxylic acid Usage And Synthesis |
| Uses | 3-Oxo-4-aza-5a-androstan-17b-carboxylic Acid is an impurity in the synthetic process of Dutasteride (D735000), a dual inhibitor of 5a-reductase isoenzymes type 1 and 2; structurally related to Finasteride (F342000). Dutasteride is used in the treatment of benign prostatic hyperplasia. |
| | 3-Oxo-4-aza-5-alpha-androstane-17-beta-carboxylic acid Preparation Products And Raw materials |
|