|
|
| | 2-Amino-3-methoxybenzonitrile Basic information |
| | 2-Amino-3-methoxybenzonitrile Chemical Properties |
| Boiling point | 286.9±30.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 1.75±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H8N2O/c1-11-7-4-2-3-6(5-9)8(7)10/h2-4H,10H2,1H3 | | InChIKey | KLCPAKMBBMVXMD-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=CC(OC)=C1N |
| | 2-Amino-3-methoxybenzonitrile Usage And Synthesis |
| Uses | 2-Amino-3-methoxybenzonitrile is used to prepare cyclic guanidines as dual 5-HT5A/5-HT7 receptor ligands. It is also used to prepare 2- and 3-aminobenzo[b]thiophenes as antimitotic agents. |
| | 2-Amino-3-methoxybenzonitrile Preparation Products And Raw materials |
|