(S)-1-Boc-3-benzylpiperazine manufacturers
|
| | (S)-1-Boc-3-benzylpiperazine Basic information |
| Product Name: | (S)-1-Boc-3-benzylpiperazine | | Synonyms: | (3S)-3-benzylpiperazine-1-carboxylic acid tert-butyl ester;(S)-1-Boc-3-benzyl-piperazine;(S)-tert-Butyl 3-benzylpiperazine-1-carboxylate;(S)-4-Boc-2-benzyl-piperazine;(S)-4-N-BOC-2-BENZYLPIPERAZINE -HCl;S-1-Boc-3-benzylylpiperazine;tert-butyl (S)-3-benzylpiperazine-1-carboxylate;1-Piperazinecarboxylic acid, 3-(phenylmethyl)-, 1,1-dimethylethyl ester, (3S)- | | CAS: | 475272-55-0 | | MF: | C16H24N2O2 | | MW: | 276.37 | | EINECS: | | | Product Categories: | Piperazine series;Piperaizine | | Mol File: | 475272-55-0.mol |  |
| | (S)-1-Boc-3-benzylpiperazine Chemical Properties |
| Boiling point | 379.8±22.0 °C(Predicted) | | density | 1.066±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 8.45±0.40(Predicted) | | Appearance | White to yellow Solid-Liquid Mixture | | InChI | InChI=1S/C16H24N2O2/c1-16(2,3)20-15(19)18-10-9-17-14(12-18)11-13-7-5-4-6-8-13/h4-8,14,17H,9-12H2,1-3H3/t14-/m0/s1 | | InChIKey | YFIAVMMGSRDLLG-AWEZNQCLSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCN[C@@H](CC2=CC=CC=C2)C1 |
| | (S)-1-Boc-3-benzylpiperazine Usage And Synthesis |
| | (S)-1-Boc-3-benzylpiperazine Preparation Products And Raw materials |
|