|
|
| | (S)-3-Amino-3-phenyl propionic acid methylester HCl Basic information |
| Product Name: | (S)-3-Amino-3-phenyl propionic acid methylester HCl | | Synonyms: | (S)-3-Amino-3-phenyl propionic acid methylester HCl;(S)-3-AMino-3-phenyl propionic acid Methylester HC;Methyl (S)-3-phenyl-beta-alaninate HCl;Benzenepropanoic acid, β-amino-, methyl ester, hydrochloride, (βS)-;(S)-Methyl 3-amino-3-phenylpropanoate hydrochloride;Benzenepropanoic acid, b-amino-, methyl ester,hydrochloride (1:1), (bS)-;Benzenepropanoicacid, b-amino-, methyl ester,hydrochloride, (S)-;(betaS)-beta-Aminobenzenepropanoic acid methyl ester hydrochloride | | CAS: | 144494-72-4 | | MF: | C10H14ClNO2 | | MW: | 215.68 | | EINECS: | | | Product Categories: | | | Mol File: | 144494-72-4.mol |  |
| | (S)-3-Amino-3-phenyl propionic acid methylester HCl Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | White to off-white Solid | | Optical Rotation | Consistent with structure | | InChI | InChI=1/C10H13NO2.ClH/c1-13-10(12)7-9(11)8-5-3-2-4-6-8;/h2-6,9H,7,11H2,1H3;1H/t9-;/s3 | | InChIKey | GYKTZBZYSKZYDB-OVMXBOEKNA-N | | SMILES | [C@H](C1C=CC=CC=1)(N)CC(=O)OC.Cl |&1:0,r| |
| | (S)-3-Amino-3-phenyl propionic acid methylester HCl Usage And Synthesis |
| | (S)-3-Amino-3-phenyl propionic acid methylester HCl Preparation Products And Raw materials |
|