|
|
| | Methyl 2-amino-4,5-difluorobenzoate Basic information |
| Product Name: | Methyl 2-amino-4,5-difluorobenzoate | | Synonyms: | Methyl 2-amino-4,5-difluorobenzoate;Benzoic acid, 2-amino-4,5-difluoro-, methyl ester (9CI);Benzoic acid, 2-amino-4,5-difluoro-, methyl ester;ETHYL2-AMINO-4,5-DIFLUOROBENZOATE;Methyl 2-amino-4,5-d;2-aMino-4,5-difluoro-benzoic acid,Methyl ester, Methyl 4,5-difluoroanthranilate, 2-aMino-4,5-difluoro-benzoic acid, Methyl ester, Methyl 2-aMino-4,5-difluorobenzoate;Methyl2-amino-4,5-difluorobenzoate,98%;Methyl 2-amino-4,5-difluorobenzoate USP/EP/BP | | CAS: | 207346-42-7 | | MF: | C8H7F2NO2 | | MW: | 187.14 | | EINECS: | | | Product Categories: | Esters;Phenyls & Phenyl-Het;AMINOACID;Phenylacetic acid | | Mol File: | 207346-42-7.mol |  |
| | Methyl 2-amino-4,5-difluorobenzoate Chemical Properties |
| Boiling point | 274.1±40.0 °C(Predicted) | | density | 1.355±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | form | Solid | | pka | 1.33±0.10(Predicted) | | color | White | | InChI | InChI=1S/C8H7F2NO2/c1-13-8(12)4-2-5(9)6(10)3-7(4)11/h2-3H,11H2,1H3 | | InChIKey | VIAQNTRKUPBQKR-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(F)=C(F)C=C1N |
| | Methyl 2-amino-4,5-difluorobenzoate Usage And Synthesis |
| Synthesis | Step 3: Methyl 4,5-difluoro-2-nitrobenzoate (23.0 g, 106 mmol) was dissolved in EtOAc (200 mL) and 10% Pd/C catalyst (wet, 50% water content, 6.0 g) was added. The reaction mixture was placed in a Parr hydrogenation reactor and the reaction was oscillated at 50 PSI hydrogen pressure for 3 hours. Upon completion of the reaction, the catalyst was removed by filtration through a diatomaceous earth pad, and the filtrate was concentrated by rotary evaporation to afford methyl 2-amino-4,5-difluorobenzoate (1c) as a colorless solid with a yield of 19.0 g in 96% yield. | | References | [1] Patent: WO2008/36843, 2008, A2. Location in patent: Page/Page column 33 |
| | Methyl 2-amino-4,5-difluorobenzoate Preparation Products And Raw materials |
|