| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 5,10,15,20-Tetrakis(pentafluorophenyl)-2 Basic information |
| Product Name: | 5,10,15,20-Tetrakis(pentafluorophenyl)-2 | | Synonyms: | YL)-21H,23H-PORPHINE PALLADIUM (II);Palladium(II) meso-tetra(pentafluorophenyl)porphine;palladium(2+),5,10,15,20-tetrakis(2,3,4,5,6-pentafluorophenyl)-1,4,5,10,11,14,15,20,21,23-decahydroporphyrin-22,24-diide;Racemic-tetra (Pentafluorophenyl) Porphyrin Palladium (II);5,10,15,20-Tetrakis(pentafluorophenyl)-21H,23H-porphine palladium(II);5，10，15，20-Tetrakis(pentafluorophenyl)-21H，23H-porphine palladium(Ⅱ);Palladium meso-tetra(pentafluorophenyl)porphyrin;5,10,15,20-Tetrakis(pentafluorophenyl)-2 | | CAS: | 72076-09-6 | | MF: | C44H8F20N4Pd | | MW: | 1078.96 | | EINECS: | | | Product Categories: | Porphyrins | | Mol File: | 72076-09-6.mol |  |
| | 5,10,15,20-Tetrakis(pentafluorophenyl)-2 Chemical Properties |
| Melting point | >300 °C (dec.) | | storage temp. | -20°C | | form | solid | | λmax | 400 nm in acetone | | InChIKey | GRRRJZUTYPIXFO-HQJDZOCDSA-N | | SMILES | Fc1c(F)c(F)c(c(F)c1F)-c2c3ccc(n3)c(-c4c(F)c(F)c(F)c(F)c4F)c5ccc6c(-c7c(F)c(F)c(F)c(F)c7F)c8ccc(n8)c(-c9c(F)c(F)c(F)c(F)c9F)c%10ccc2n%10[Pd]n56 |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | 5,10,15,20-Tetrakis(pentafluorophenyl)-2 Usage And Synthesis |
| Uses | It can be used as a porphyrin dye with a high quantum yield for use in the fabrication of oxygen sensors. | | General Description | 5,10,15,20-Tetrakis(pentafluorophenyl)-21H,23H-porphine palladium(II) is a phosphorescent dye that is a derivative of palladium(II). It can be used as a singlet oxygen sensitizer due to the presence of fluorine atoms. It provides photostability and is resistant to oxidation. |
| | 5,10,15,20-Tetrakis(pentafluorophenyl)-2 Preparation Products And Raw materials |
|