| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Dihydroxyfumaric acid hydrate, 98% manufacturers
|
| | Dihydroxyfumaric acid hydrate, 98% Basic information |
| | Dihydroxyfumaric acid hydrate, 98% Chemical Properties |
| Melting point | 156 °C (dec.)(lit.) | | storage temp. | 2-8°C | | form | Solid | | color | White to off-white | | BRN | 1724790 | | InChI | 1S/C4H4O6.H2O/c5-1(3(7)8)2(6)4(9)10;/h5-6H,(H,7,8)(H,9,10);1H2/b2-1+; | | InChIKey | DDYHTXQJGPQZGN-TYYBGVCCSA-N | | SMILES | O.OC(=O)\C(O)=C(/O)C(O)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Dihydroxyfumaric acid hydrate, 98% Usage And Synthesis |
| Uses | (2E)-2,3-Dihydroxy-2-butenedioic Acid Hydrate (1:), is an organic building block used for the synthesis of various chemicals. It is also shown to be to the product of oxidative degradation pathway in wine, and it can produce yellow pigments by reacting with (+)-catechin. |
| | Dihydroxyfumaric acid hydrate, 98% Preparation Products And Raw materials |
|